1525 lines
50 KiB
Rust
1525 lines
50 KiB
Rust
//! Module defining the AST (abstract syntax tree).
|
|
|
|
use crate::dynamic::{AccessMode, Union};
|
|
use crate::fn_native::shared_make_mut;
|
|
use crate::module::NamespaceRef;
|
|
use crate::stdlib::{
|
|
borrow::Cow,
|
|
boxed::Box,
|
|
fmt,
|
|
hash::Hash,
|
|
num::{NonZeroU64, NonZeroUsize},
|
|
ops::{Add, AddAssign},
|
|
string::String,
|
|
vec,
|
|
vec::Vec,
|
|
};
|
|
use crate::token::Token;
|
|
use crate::utils::{HashableHashMap, StraightHasherBuilder};
|
|
use crate::{
|
|
Dynamic, FnNamespace, FnPtr, ImmutableString, Module, Position, Shared, StaticVec, INT,
|
|
};
|
|
|
|
#[cfg(not(feature = "no_float"))]
|
|
use crate::FLOAT;
|
|
|
|
#[cfg(not(feature = "no_index"))]
|
|
use crate::Array;
|
|
|
|
#[cfg(not(feature = "no_object"))]
|
|
use crate::Map;
|
|
|
|
/// A type representing the access mode of a function.
|
|
#[derive(Debug, Clone, Copy, Eq, PartialEq, Hash)]
|
|
pub enum FnAccess {
|
|
/// Public function.
|
|
Public,
|
|
/// Private function.
|
|
Private,
|
|
}
|
|
|
|
impl FnAccess {
|
|
/// Is this access mode [private][FnAccess::Private]?
|
|
#[inline(always)]
|
|
pub fn is_private(self) -> bool {
|
|
match self {
|
|
Self::Private => true,
|
|
Self::Public => false,
|
|
}
|
|
}
|
|
/// Is this access mode [public][FnAccess::Public]?
|
|
#[inline(always)]
|
|
pub fn is_public(self) -> bool {
|
|
match self {
|
|
Self::Private => false,
|
|
Self::Public => true,
|
|
}
|
|
}
|
|
}
|
|
|
|
/// _(INTERNALS)_ A type containing information on a scripted function.
|
|
/// Exported under the `internals` feature only.
|
|
///
|
|
/// # Volatile Data Structure
|
|
///
|
|
/// This type is volatile and may change.
|
|
#[derive(Debug, Clone)]
|
|
pub struct ScriptFnDef {
|
|
/// Function body.
|
|
pub body: Stmt,
|
|
/// Encapsulated running environment, if any.
|
|
pub lib: Option<Shared<Module>>,
|
|
/// Encapsulated imported modules.
|
|
#[cfg(not(feature = "no_module"))]
|
|
pub mods: crate::engine::Imports,
|
|
/// Function name.
|
|
pub name: ImmutableString,
|
|
/// Function access mode.
|
|
pub access: FnAccess,
|
|
/// Names of function parameters.
|
|
pub params: StaticVec<ImmutableString>,
|
|
/// Access to external variables.
|
|
#[cfg(not(feature = "no_closure"))]
|
|
pub externals: Vec<ImmutableString>,
|
|
/// Function doc-comments (if any).
|
|
pub comments: Vec<String>,
|
|
}
|
|
|
|
impl fmt::Display for ScriptFnDef {
|
|
#[inline(always)]
|
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
|
write!(
|
|
f,
|
|
"{}{}({})",
|
|
if self.access.is_private() {
|
|
"private "
|
|
} else {
|
|
""
|
|
},
|
|
self.name,
|
|
self.params
|
|
.iter()
|
|
.map(|s| s.as_str())
|
|
.collect::<Vec<_>>()
|
|
.join(", ")
|
|
)
|
|
}
|
|
}
|
|
|
|
/// A type containing the metadata of a script-defined function.
|
|
///
|
|
/// Created by [`AST::iter_functions`].
|
|
#[derive(Debug, Eq, PartialEq, Clone, Hash)]
|
|
pub struct ScriptFnMetadata<'a> {
|
|
/// Function doc-comments (if any).
|
|
///
|
|
/// Block doc-comments are kept in a single string slice with line-breaks within.
|
|
///
|
|
/// Line doc-comments are kept in one string slice per line without the termination line-break.
|
|
///
|
|
/// Leading white-spaces are stripped, and each string slice always starts with the corresponding
|
|
/// doc-comment leader: `///` or `/**`.
|
|
pub comments: Vec<&'a str>,
|
|
/// Function access mode.
|
|
pub access: FnAccess,
|
|
/// Function name.
|
|
pub name: &'a str,
|
|
/// Function parameters (if any).
|
|
pub params: Vec<&'a str>,
|
|
}
|
|
|
|
impl fmt::Display for ScriptFnMetadata<'_> {
|
|
#[inline(always)]
|
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
|
write!(
|
|
f,
|
|
"{}{}({})",
|
|
if self.access.is_private() {
|
|
"private "
|
|
} else {
|
|
""
|
|
},
|
|
self.name,
|
|
self.params.iter().cloned().collect::<Vec<_>>().join(", ")
|
|
)
|
|
}
|
|
}
|
|
|
|
impl<'a> Into<ScriptFnMetadata<'a>> for &'a ScriptFnDef {
|
|
#[inline(always)]
|
|
fn into(self) -> ScriptFnMetadata<'a> {
|
|
ScriptFnMetadata {
|
|
comments: self.comments.iter().map(|s| s.as_str()).collect(),
|
|
access: self.access,
|
|
name: &self.name,
|
|
params: self.params.iter().map(|s| s.as_str()).collect(),
|
|
}
|
|
}
|
|
}
|
|
|
|
/// Compiled AST (abstract syntax tree) of a Rhai script.
|
|
///
|
|
/// # Thread Safety
|
|
///
|
|
/// Currently, [`AST`] is neither `Send` nor `Sync`. Turn on the `sync` feature to make it `Send + Sync`.
|
|
#[derive(Debug, Clone)]
|
|
pub struct AST {
|
|
/// Source of the [`AST`].
|
|
source: Option<ImmutableString>,
|
|
/// Global statements.
|
|
statements: Vec<Stmt>,
|
|
/// Script-defined functions.
|
|
functions: Shared<Module>,
|
|
/// Embedded module resolver, if any.
|
|
#[cfg(not(feature = "no_module"))]
|
|
resolver: Option<Shared<crate::module::resolvers::StaticModuleResolver>>,
|
|
}
|
|
|
|
impl Default for AST {
|
|
#[inline(always)]
|
|
fn default() -> Self {
|
|
Self {
|
|
source: None,
|
|
statements: Vec::with_capacity(16),
|
|
functions: Default::default(),
|
|
#[cfg(not(feature = "no_module"))]
|
|
resolver: None,
|
|
}
|
|
}
|
|
}
|
|
|
|
impl AST {
|
|
/// Create a new [`AST`].
|
|
#[inline(always)]
|
|
pub fn new(
|
|
statements: impl IntoIterator<Item = Stmt>,
|
|
functions: impl Into<Shared<Module>>,
|
|
) -> Self {
|
|
Self {
|
|
source: None,
|
|
statements: statements.into_iter().collect(),
|
|
functions: functions.into(),
|
|
#[cfg(not(feature = "no_module"))]
|
|
resolver: None,
|
|
}
|
|
}
|
|
/// Create a new [`AST`] with a source name.
|
|
#[inline(always)]
|
|
pub fn new_with_source(
|
|
statements: impl IntoIterator<Item = Stmt>,
|
|
functions: impl Into<Shared<Module>>,
|
|
source: impl Into<ImmutableString>,
|
|
) -> Self {
|
|
Self {
|
|
source: Some(source.into()),
|
|
statements: statements.into_iter().collect(),
|
|
functions: functions.into(),
|
|
#[cfg(not(feature = "no_module"))]
|
|
resolver: None,
|
|
}
|
|
}
|
|
/// Get the source, if any.
|
|
#[inline(always)]
|
|
pub fn source(&self) -> Option<&str> {
|
|
self.source.as_ref().map(|s| s.as_str())
|
|
}
|
|
/// Clone the source, if any.
|
|
#[inline(always)]
|
|
pub(crate) fn clone_source(&self) -> Option<ImmutableString> {
|
|
self.source.clone()
|
|
}
|
|
/// Set the source.
|
|
#[inline(always)]
|
|
pub fn set_source(&mut self, source: impl Into<ImmutableString>) -> &mut Self {
|
|
self.source = Some(source.into());
|
|
|
|
if let Some(module) = Shared::get_mut(&mut self.functions) {
|
|
module.set_id(self.source.clone());
|
|
}
|
|
|
|
self
|
|
}
|
|
/// Clear the source.
|
|
#[inline(always)]
|
|
pub fn clear_source(&mut self) -> &mut Self {
|
|
self.source = None;
|
|
self
|
|
}
|
|
/// Get the statements.
|
|
#[cfg(not(feature = "internals"))]
|
|
#[inline(always)]
|
|
pub(crate) fn statements(&self) -> &[Stmt] {
|
|
&self.statements
|
|
}
|
|
/// _(INTERNALS)_ Get the statements.
|
|
/// Exported under the `internals` feature only.
|
|
#[cfg(feature = "internals")]
|
|
#[deprecated = "this method is volatile and may change"]
|
|
#[inline(always)]
|
|
pub fn statements(&self) -> &[Stmt] {
|
|
&self.statements
|
|
}
|
|
/// Get a mutable reference to the statements.
|
|
#[cfg(not(feature = "no_optimize"))]
|
|
#[inline(always)]
|
|
pub(crate) fn statements_mut(&mut self) -> &mut Vec<Stmt> {
|
|
&mut self.statements
|
|
}
|
|
/// Get the internal shared [`Module`] containing all script-defined functions.
|
|
#[cfg(not(feature = "internals"))]
|
|
#[cfg(not(feature = "no_module"))]
|
|
#[cfg(not(feature = "no_function"))]
|
|
#[inline(always)]
|
|
pub(crate) fn shared_lib(&self) -> Shared<Module> {
|
|
self.functions.clone()
|
|
}
|
|
/// _(INTERNALS)_ Get the internal shared [`Module`] containing all script-defined functions.
|
|
/// Exported under the `internals` feature only.
|
|
#[cfg(feature = "internals")]
|
|
#[deprecated = "this method is volatile and may change"]
|
|
#[cfg(not(feature = "no_module"))]
|
|
#[cfg(not(feature = "no_function"))]
|
|
#[inline(always)]
|
|
pub fn shared_lib(&self) -> Shared<Module> {
|
|
self.functions.clone()
|
|
}
|
|
/// Get the internal [`Module`] containing all script-defined functions.
|
|
#[cfg(not(feature = "internals"))]
|
|
#[inline(always)]
|
|
pub(crate) fn lib(&self) -> &Module {
|
|
&self.functions
|
|
}
|
|
/// _(INTERNALS)_ Get the internal [`Module`] containing all script-defined functions.
|
|
/// Exported under the `internals` feature only.
|
|
#[cfg(feature = "internals")]
|
|
#[deprecated = "this method is volatile and may change"]
|
|
#[inline(always)]
|
|
pub fn lib(&self) -> &Module {
|
|
&self.functions
|
|
}
|
|
/// Get the embedded [module resolver][`ModuleResolver`].
|
|
#[cfg(not(feature = "no_module"))]
|
|
#[cfg(not(feature = "internals"))]
|
|
#[inline(always)]
|
|
pub(crate) fn resolver(
|
|
&self,
|
|
) -> Option<Shared<crate::module::resolvers::StaticModuleResolver>> {
|
|
self.resolver.clone()
|
|
}
|
|
/// _(INTERNALS)_ Get the embedded [module resolver][crate::ModuleResolver].
|
|
/// Exported under the `internals` feature only.
|
|
#[cfg(not(feature = "no_module"))]
|
|
#[cfg(feature = "internals")]
|
|
#[inline(always)]
|
|
pub fn resolver(&self) -> Option<Shared<crate::module::resolvers::StaticModuleResolver>> {
|
|
self.resolver.clone()
|
|
}
|
|
/// Set the embedded [module resolver][`ModuleResolver`].
|
|
#[cfg(not(feature = "no_module"))]
|
|
#[inline(always)]
|
|
pub(crate) fn set_resolver(
|
|
&mut self,
|
|
resolver: impl Into<Shared<crate::module::resolvers::StaticModuleResolver>>,
|
|
) -> &mut Self {
|
|
self.resolver = Some(resolver.into());
|
|
self
|
|
}
|
|
/// Clone the [`AST`]'s functions into a new [`AST`].
|
|
/// No statements are cloned.
|
|
///
|
|
/// This operation is cheap because functions are shared.
|
|
///
|
|
/// Not available under `no_function`.
|
|
#[cfg(not(feature = "no_function"))]
|
|
#[inline(always)]
|
|
pub fn clone_functions_only(&self) -> Self {
|
|
self.clone_functions_only_filtered(|_, _, _, _, _| true)
|
|
}
|
|
/// Clone the [`AST`]'s functions into a new [`AST`] based on a filter predicate.
|
|
/// No statements are cloned.
|
|
///
|
|
/// This operation is cheap because functions are shared.
|
|
///
|
|
/// Not available under `no_function`.
|
|
#[cfg(not(feature = "no_function"))]
|
|
#[inline(always)]
|
|
pub fn clone_functions_only_filtered(
|
|
&self,
|
|
mut filter: impl FnMut(FnNamespace, FnAccess, bool, &str, usize) -> bool,
|
|
) -> Self {
|
|
let mut functions: Module = Default::default();
|
|
functions.merge_filtered(&self.functions, &mut filter);
|
|
Self {
|
|
source: self.source.clone(),
|
|
statements: Default::default(),
|
|
functions: functions.into(),
|
|
#[cfg(not(feature = "no_module"))]
|
|
resolver: self.resolver.clone(),
|
|
}
|
|
}
|
|
/// Clone the [`AST`]'s script statements into a new [`AST`].
|
|
/// No functions are cloned.
|
|
#[inline(always)]
|
|
pub fn clone_statements_only(&self) -> Self {
|
|
Self {
|
|
source: self.source.clone(),
|
|
statements: self.statements.clone(),
|
|
functions: Default::default(),
|
|
#[cfg(not(feature = "no_module"))]
|
|
resolver: self.resolver.clone(),
|
|
}
|
|
}
|
|
/// Merge two [`AST`] into one. Both [`AST`]'s are untouched and a new, merged, version
|
|
/// is returned.
|
|
///
|
|
/// Statements in the second [`AST`] are simply appended to the end of the first _without any processing_.
|
|
/// Thus, the return value of the first [`AST`] (if using expression-statement syntax) is buried.
|
|
/// Of course, if the first [`AST`] uses a `return` statement at the end, then
|
|
/// the second [`AST`] will essentially be dead code.
|
|
///
|
|
/// All script-defined functions in the second [`AST`] overwrite similarly-named functions
|
|
/// in the first [`AST`] with the same number of parameters.
|
|
///
|
|
/// # Example
|
|
///
|
|
/// ```
|
|
/// # fn main() -> Result<(), Box<rhai::EvalAltResult>> {
|
|
/// # #[cfg(not(feature = "no_function"))]
|
|
/// # {
|
|
/// use rhai::Engine;
|
|
///
|
|
/// let engine = Engine::new();
|
|
///
|
|
/// let ast1 = engine.compile(r#"
|
|
/// fn foo(x) { 42 + x }
|
|
/// foo(1)
|
|
/// "#)?;
|
|
///
|
|
/// let ast2 = engine.compile(r#"
|
|
/// fn foo(n) { "hello" + n }
|
|
/// foo("!")
|
|
/// "#)?;
|
|
///
|
|
/// let ast = ast1.merge(&ast2); // Merge 'ast2' into 'ast1'
|
|
///
|
|
/// // Notice that using the '+' operator also works:
|
|
/// // let ast = &ast1 + &ast2;
|
|
///
|
|
/// // 'ast' is essentially:
|
|
/// //
|
|
/// // fn foo(n) { "hello" + n } // <- definition of first 'foo' is overwritten
|
|
/// // foo(1) // <- notice this will be "hello1" instead of 43,
|
|
/// // // but it is no longer the return value
|
|
/// // foo("!") // returns "hello!"
|
|
///
|
|
/// // Evaluate it
|
|
/// assert_eq!(engine.eval_ast::<String>(&ast)?, "hello!");
|
|
/// # }
|
|
/// # Ok(())
|
|
/// # }
|
|
/// ```
|
|
#[inline(always)]
|
|
pub fn merge(&self, other: &Self) -> Self {
|
|
self.merge_filtered(other, |_, _, _, _, _| true)
|
|
}
|
|
/// Combine one [`AST`] with another. The second [`AST`] is consumed.
|
|
///
|
|
/// Statements in the second [`AST`] are simply appended to the end of the first _without any processing_.
|
|
/// Thus, the return value of the first [`AST`] (if using expression-statement syntax) is buried.
|
|
/// Of course, if the first [`AST`] uses a `return` statement at the end, then
|
|
/// the second [`AST`] will essentially be dead code.
|
|
///
|
|
/// All script-defined functions in the second [`AST`] overwrite similarly-named functions
|
|
/// in the first [`AST`] with the same number of parameters.
|
|
///
|
|
/// # Example
|
|
///
|
|
/// ```
|
|
/// # fn main() -> Result<(), Box<rhai::EvalAltResult>> {
|
|
/// # #[cfg(not(feature = "no_function"))]
|
|
/// # {
|
|
/// use rhai::Engine;
|
|
///
|
|
/// let engine = Engine::new();
|
|
///
|
|
/// let mut ast1 = engine.compile(r#"
|
|
/// fn foo(x) { 42 + x }
|
|
/// foo(1)
|
|
/// "#)?;
|
|
///
|
|
/// let ast2 = engine.compile(r#"
|
|
/// fn foo(n) { "hello" + n }
|
|
/// foo("!")
|
|
/// "#)?;
|
|
///
|
|
/// ast1.combine(ast2); // Combine 'ast2' into 'ast1'
|
|
///
|
|
/// // Notice that using the '+=' operator also works:
|
|
/// // ast1 += ast2;
|
|
///
|
|
/// // 'ast1' is essentially:
|
|
/// //
|
|
/// // fn foo(n) { "hello" + n } // <- definition of first 'foo' is overwritten
|
|
/// // foo(1) // <- notice this will be "hello1" instead of 43,
|
|
/// // // but it is no longer the return value
|
|
/// // foo("!") // returns "hello!"
|
|
///
|
|
/// // Evaluate it
|
|
/// assert_eq!(engine.eval_ast::<String>(&ast1)?, "hello!");
|
|
/// # }
|
|
/// # Ok(())
|
|
/// # }
|
|
/// ```
|
|
#[inline(always)]
|
|
pub fn combine(&mut self, other: Self) -> &mut Self {
|
|
self.combine_filtered(other, |_, _, _, _, _| true)
|
|
}
|
|
/// Merge two [`AST`] into one. Both [`AST`]'s are untouched and a new, merged, version
|
|
/// is returned.
|
|
///
|
|
/// Statements in the second [`AST`] are simply appended to the end of the first _without any processing_.
|
|
/// Thus, the return value of the first [`AST`] (if using expression-statement syntax) is buried.
|
|
/// Of course, if the first [`AST`] uses a `return` statement at the end, then
|
|
/// the second [`AST`] will essentially be dead code.
|
|
///
|
|
/// All script-defined functions in the second [`AST`] are first selected based on a filter
|
|
/// predicate, then overwrite similarly-named functions in the first [`AST`] with the
|
|
/// same number of parameters.
|
|
///
|
|
/// # Example
|
|
///
|
|
/// ```
|
|
/// # fn main() -> Result<(), Box<rhai::EvalAltResult>> {
|
|
/// # #[cfg(not(feature = "no_function"))]
|
|
/// # {
|
|
/// use rhai::Engine;
|
|
///
|
|
/// let engine = Engine::new();
|
|
///
|
|
/// let ast1 = engine.compile(r#"
|
|
/// fn foo(x) { 42 + x }
|
|
/// foo(1)
|
|
/// "#)?;
|
|
///
|
|
/// let ast2 = engine.compile(r#"
|
|
/// fn foo(n) { "hello" + n }
|
|
/// fn error() { 0 }
|
|
/// foo("!")
|
|
/// "#)?;
|
|
///
|
|
/// // Merge 'ast2', picking only 'error()' but not 'foo(_)', into 'ast1'
|
|
/// let ast = ast1.merge_filtered(&ast2, |_, _, script, name, params|
|
|
/// script && name == "error" && params == 0);
|
|
///
|
|
/// // 'ast' is essentially:
|
|
/// //
|
|
/// // fn foo(n) { 42 + n } // <- definition of 'ast1::foo' is not overwritten
|
|
/// // // because 'ast2::foo' is filtered away
|
|
/// // foo(1) // <- notice this will be 43 instead of "hello1",
|
|
/// // // but it is no longer the return value
|
|
/// // fn error() { 0 } // <- this function passes the filter and is merged
|
|
/// // foo("!") // <- returns "42!"
|
|
///
|
|
/// // Evaluate it
|
|
/// assert_eq!(engine.eval_ast::<String>(&ast)?, "42!");
|
|
/// # }
|
|
/// # Ok(())
|
|
/// # }
|
|
/// ```
|
|
#[inline]
|
|
pub fn merge_filtered(
|
|
&self,
|
|
other: &Self,
|
|
mut filter: impl FnMut(FnNamespace, FnAccess, bool, &str, usize) -> bool,
|
|
) -> Self {
|
|
let Self {
|
|
statements,
|
|
functions,
|
|
..
|
|
} = self;
|
|
|
|
let ast = match (statements.is_empty(), other.statements.is_empty()) {
|
|
(false, false) => {
|
|
let mut statements = statements.clone();
|
|
statements.extend(other.statements.iter().cloned());
|
|
statements
|
|
}
|
|
(false, true) => statements.clone(),
|
|
(true, false) => other.statements.clone(),
|
|
(true, true) => vec![],
|
|
};
|
|
|
|
let source = other.source.clone().or_else(|| self.source.clone());
|
|
|
|
let mut functions = functions.as_ref().clone();
|
|
functions.merge_filtered(&other.functions, &mut filter);
|
|
|
|
if let Some(source) = source {
|
|
Self::new_with_source(ast, functions, source)
|
|
} else {
|
|
Self::new(ast, functions)
|
|
}
|
|
}
|
|
/// Combine one [`AST`] with another. The second [`AST`] is consumed.
|
|
///
|
|
/// Statements in the second [`AST`] are simply appended to the end of the first _without any processing_.
|
|
/// Thus, the return value of the first [`AST`] (if using expression-statement syntax) is buried.
|
|
/// Of course, if the first [`AST`] uses a `return` statement at the end, then
|
|
/// the second [`AST`] will essentially be dead code.
|
|
///
|
|
/// All script-defined functions in the second [`AST`] are first selected based on a filter
|
|
/// predicate, then overwrite similarly-named functions in the first [`AST`] with the
|
|
/// same number of parameters.
|
|
///
|
|
/// # Example
|
|
///
|
|
/// ```
|
|
/// # fn main() -> Result<(), Box<rhai::EvalAltResult>> {
|
|
/// # #[cfg(not(feature = "no_function"))]
|
|
/// # {
|
|
/// use rhai::Engine;
|
|
///
|
|
/// let engine = Engine::new();
|
|
///
|
|
/// let mut ast1 = engine.compile(r#"
|
|
/// fn foo(x) { 42 + x }
|
|
/// foo(1)
|
|
/// "#)?;
|
|
///
|
|
/// let ast2 = engine.compile(r#"
|
|
/// fn foo(n) { "hello" + n }
|
|
/// fn error() { 0 }
|
|
/// foo("!")
|
|
/// "#)?;
|
|
///
|
|
/// // Combine 'ast2', picking only 'error()' but not 'foo(_)', into 'ast1'
|
|
/// ast1.combine_filtered(ast2, |_, _, script, name, params|
|
|
/// script && name == "error" && params == 0);
|
|
///
|
|
/// // 'ast1' is essentially:
|
|
/// //
|
|
/// // fn foo(n) { 42 + n } // <- definition of 'ast1::foo' is not overwritten
|
|
/// // // because 'ast2::foo' is filtered away
|
|
/// // foo(1) // <- notice this will be 43 instead of "hello1",
|
|
/// // // but it is no longer the return value
|
|
/// // fn error() { 0 } // <- this function passes the filter and is merged
|
|
/// // foo("!") // <- returns "42!"
|
|
///
|
|
/// // Evaluate it
|
|
/// assert_eq!(engine.eval_ast::<String>(&ast1)?, "42!");
|
|
/// # }
|
|
/// # Ok(())
|
|
/// # }
|
|
/// ```
|
|
#[inline(always)]
|
|
pub fn combine_filtered(
|
|
&mut self,
|
|
other: Self,
|
|
mut filter: impl FnMut(FnNamespace, FnAccess, bool, &str, usize) -> bool,
|
|
) -> &mut Self {
|
|
self.statements.extend(other.statements.into_iter());
|
|
if !other.functions.is_empty() {
|
|
shared_make_mut(&mut self.functions).merge_filtered(&other.functions, &mut filter);
|
|
}
|
|
self
|
|
}
|
|
/// Filter out the functions, retaining only some based on a filter predicate.
|
|
///
|
|
/// Not available under `no_function`.
|
|
///
|
|
/// # Example
|
|
///
|
|
/// ```
|
|
/// # fn main() -> Result<(), Box<rhai::EvalAltResult>> {
|
|
/// # #[cfg(not(feature = "no_function"))]
|
|
/// # {
|
|
/// use rhai::Engine;
|
|
///
|
|
/// let engine = Engine::new();
|
|
///
|
|
/// let mut ast = engine.compile(r#"
|
|
/// fn foo(n) { n + 1 }
|
|
/// fn bar() { print("hello"); }
|
|
/// "#)?;
|
|
///
|
|
/// // Remove all functions except 'foo(_)'
|
|
/// ast.retain_functions(|_, _, name, params| name == "foo" && params == 1);
|
|
/// # }
|
|
/// # Ok(())
|
|
/// # }
|
|
/// ```
|
|
#[cfg(not(feature = "no_function"))]
|
|
#[inline(always)]
|
|
pub fn retain_functions(
|
|
&mut self,
|
|
filter: impl FnMut(FnNamespace, FnAccess, &str, usize) -> bool,
|
|
) -> &mut Self {
|
|
if !self.functions.is_empty() {
|
|
shared_make_mut(&mut self.functions).retain_script_functions(filter);
|
|
}
|
|
self
|
|
}
|
|
/// Iterate through all function definitions.
|
|
///
|
|
/// Not available under [`no_function`].
|
|
#[cfg(not(feature = "no_function"))]
|
|
#[cfg(not(feature = "no_module"))]
|
|
#[inline(always)]
|
|
pub(crate) fn iter_fn_def(&self) -> impl Iterator<Item = &ScriptFnDef> {
|
|
self.functions
|
|
.iter_script_fn()
|
|
.map(|(_, _, _, _, fn_def)| fn_def)
|
|
}
|
|
/// Iterate through all function definitions.
|
|
///
|
|
/// Not available under `no_function`.
|
|
#[cfg(not(feature = "no_function"))]
|
|
#[inline(always)]
|
|
pub fn iter_functions<'a>(&'a self) -> impl Iterator<Item = ScriptFnMetadata> + 'a {
|
|
self.functions
|
|
.iter_script_fn()
|
|
.map(|(_, _, _, _, fn_def)| fn_def.into())
|
|
}
|
|
/// Clear all function definitions in the [`AST`].
|
|
///
|
|
/// Not available under `no_function`.
|
|
#[cfg(not(feature = "no_function"))]
|
|
#[inline(always)]
|
|
pub fn clear_functions(&mut self) {
|
|
self.functions = Default::default();
|
|
}
|
|
/// Clear all statements in the [`AST`], leaving only function definitions.
|
|
#[inline(always)]
|
|
pub fn clear_statements(&mut self) {
|
|
self.statements = vec![];
|
|
}
|
|
/// Recursively walk the [`AST`], including function bodies (if any).
|
|
#[cfg(not(feature = "internals"))]
|
|
#[cfg(not(feature = "no_module"))]
|
|
#[inline(always)]
|
|
pub(crate) fn walk(&self, on_node: &mut impl FnMut(&[ASTNode])) {
|
|
self.statements()
|
|
.iter()
|
|
.chain({
|
|
#[cfg(not(feature = "no_function"))]
|
|
{
|
|
self.iter_fn_def().map(|f| &f.body)
|
|
}
|
|
#[cfg(feature = "no_function")]
|
|
{
|
|
crate::stdlib::iter::empty()
|
|
}
|
|
})
|
|
.for_each(|stmt| stmt.walk(&mut Default::default(), on_node));
|
|
}
|
|
/// _(INTERNALS)_ Recursively walk the [`AST`], including function bodies (if any).
|
|
/// Exported under the `internals` feature only.
|
|
#[cfg(feature = "internals")]
|
|
#[inline(always)]
|
|
pub fn walk(&self, on_node: &mut impl FnMut(&[ASTNode])) {
|
|
self.statements()
|
|
.iter()
|
|
.chain({
|
|
#[cfg(not(feature = "no_function"))]
|
|
{
|
|
self.iter_fn_def().map(|f| &f.body)
|
|
}
|
|
#[cfg(feature = "no_function")]
|
|
{
|
|
crate::stdlib::iter::empty()
|
|
}
|
|
})
|
|
.for_each(|stmt| stmt.walk(&mut Default::default(), on_node));
|
|
}
|
|
}
|
|
|
|
impl<A: AsRef<AST>> Add<A> for &AST {
|
|
type Output = AST;
|
|
|
|
#[inline(always)]
|
|
fn add(self, rhs: A) -> Self::Output {
|
|
self.merge(rhs.as_ref())
|
|
}
|
|
}
|
|
|
|
impl<A: Into<AST>> AddAssign<A> for AST {
|
|
#[inline(always)]
|
|
fn add_assign(&mut self, rhs: A) {
|
|
self.combine(rhs.into());
|
|
}
|
|
}
|
|
|
|
impl AsRef<[Stmt]> for AST {
|
|
#[inline(always)]
|
|
fn as_ref(&self) -> &[Stmt] {
|
|
self.statements()
|
|
}
|
|
}
|
|
|
|
impl AsRef<Module> for AST {
|
|
#[inline(always)]
|
|
fn as_ref(&self) -> &Module {
|
|
self.lib()
|
|
}
|
|
}
|
|
|
|
/// _(INTERNALS)_ An identifier containing an [immutable string][ImmutableString] name and a [position][Position].
|
|
/// Exported under the `internals` feature only.
|
|
///
|
|
/// # Volatile Data Structure
|
|
///
|
|
/// This type is volatile and may change.
|
|
#[derive(Clone, Eq, PartialEq, Hash)]
|
|
pub struct Ident {
|
|
/// Identifier name.
|
|
pub name: ImmutableString,
|
|
/// Declaration position.
|
|
pub pos: Position,
|
|
}
|
|
|
|
impl fmt::Debug for Ident {
|
|
#[inline(always)]
|
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
|
write!(f, "Ident({:?} @ {:?})", self.name, self.pos)
|
|
}
|
|
}
|
|
|
|
/// _(INTERNALS)_ A type encapsulating the mode of a `return`/`throw` statement.
|
|
/// Exported under the `internals` feature only.
|
|
///
|
|
/// # Volatile Data Structure
|
|
///
|
|
/// This type is volatile and may change.
|
|
#[derive(Debug, Eq, PartialEq, Clone, Copy, Hash)]
|
|
pub enum ReturnType {
|
|
/// `return` statement.
|
|
Return,
|
|
/// `throw` statement.
|
|
Exception,
|
|
}
|
|
|
|
/// _(INTERNALS)_ An [`AST`] node, consisting of either an [`Expr`] or a [`Stmt`].
|
|
/// Exported under the `internals` feature only.
|
|
///
|
|
/// # Volatile Data Structure
|
|
///
|
|
/// This type is volatile and may change.
|
|
#[derive(Debug, Clone, Hash)]
|
|
pub enum ASTNode<'a> {
|
|
Stmt(&'a Stmt),
|
|
Expr(&'a Expr),
|
|
}
|
|
|
|
impl<'a> From<&'a Stmt> for ASTNode<'a> {
|
|
fn from(stmt: &'a Stmt) -> Self {
|
|
Self::Stmt(stmt)
|
|
}
|
|
}
|
|
|
|
impl<'a> From<&'a Expr> for ASTNode<'a> {
|
|
fn from(expr: &'a Expr) -> Self {
|
|
Self::Expr(expr)
|
|
}
|
|
}
|
|
|
|
/// _(INTERNALS)_ A statement.
|
|
/// Exported under the `internals` feature only.
|
|
///
|
|
/// # Volatile Data Structure
|
|
///
|
|
/// This type is volatile and may change.
|
|
#[derive(Debug, Clone, Hash)]
|
|
pub enum Stmt {
|
|
/// No-op.
|
|
Noop(Position),
|
|
/// `if` expr `{` stmt `}` `else` `{` stmt `}`
|
|
If(Expr, Box<(Stmt, Option<Stmt>)>, Position),
|
|
/// `switch` expr `{` literal or _ `=>` stmt `,` ... `}`
|
|
Switch(
|
|
Expr,
|
|
Box<(
|
|
HashableHashMap<u64, Stmt, StraightHasherBuilder>,
|
|
Option<Stmt>,
|
|
)>,
|
|
Position,
|
|
),
|
|
/// `while` expr `{` stmt `}`
|
|
While(Expr, Box<Stmt>, Position),
|
|
/// `do` `{` stmt `}` `while`|`until` expr
|
|
Do(Box<Stmt>, Expr, bool, Position),
|
|
/// `for` id `in` expr `{` stmt `}`
|
|
For(Expr, Box<(String, Stmt)>, Position),
|
|
/// \[`export`\] `let` id `=` expr
|
|
Let(Box<Ident>, Option<Expr>, bool, Position),
|
|
/// \[`export`\] `const` id `=` expr
|
|
Const(Box<Ident>, Option<Expr>, bool, Position),
|
|
/// expr op`=` expr
|
|
Assignment(Box<(Expr, Cow<'static, str>, Expr)>, Position),
|
|
/// `{` stmt`;` ... `}`
|
|
Block(Vec<Stmt>, Position),
|
|
/// `try` `{` stmt; ... `}` `catch` `(` var `)` `{` stmt; ... `}`
|
|
TryCatch(Box<(Stmt, Option<Ident>, Stmt)>, Position, Position),
|
|
/// [expression][Expr]
|
|
Expr(Expr),
|
|
/// `continue`
|
|
Continue(Position),
|
|
/// `break`
|
|
Break(Position),
|
|
/// `return`/`throw`
|
|
Return((ReturnType, Position), Option<Expr>, Position),
|
|
/// `import` expr `as` var
|
|
#[cfg(not(feature = "no_module"))]
|
|
Import(Expr, Option<Box<Ident>>, Position),
|
|
/// `export` var `as` var `,` ...
|
|
#[cfg(not(feature = "no_module"))]
|
|
Export(Vec<(Ident, Option<Ident>)>, Position),
|
|
/// Convert a variable to shared.
|
|
#[cfg(not(feature = "no_closure"))]
|
|
Share(Ident),
|
|
}
|
|
|
|
impl Default for Stmt {
|
|
#[inline(always)]
|
|
fn default() -> Self {
|
|
Self::Noop(Position::NONE)
|
|
}
|
|
}
|
|
|
|
impl Stmt {
|
|
/// Is this statement [`Noop`][Stmt::Noop]?
|
|
#[inline(always)]
|
|
pub fn is_noop(&self) -> bool {
|
|
match self {
|
|
Self::Noop(_) => true,
|
|
_ => false,
|
|
}
|
|
}
|
|
/// Get the [position][Position] of this statement.
|
|
pub fn position(&self) -> Position {
|
|
match self {
|
|
Self::Noop(pos)
|
|
| Self::Continue(pos)
|
|
| Self::Break(pos)
|
|
| Self::Block(_, pos)
|
|
| Self::Assignment(_, pos)
|
|
| Self::If(_, _, pos)
|
|
| Self::Switch(_, _, pos)
|
|
| Self::While(_, _, pos)
|
|
| Self::Do(_, _, _, pos)
|
|
| Self::For(_, _, pos)
|
|
| Self::Return((_, pos), _, _)
|
|
| Self::Let(_, _, _, pos)
|
|
| Self::Const(_, _, _, pos)
|
|
| Self::TryCatch(_, pos, _) => *pos,
|
|
|
|
Self::Expr(x) => x.position(),
|
|
|
|
#[cfg(not(feature = "no_module"))]
|
|
Self::Import(_, _, pos) => *pos,
|
|
#[cfg(not(feature = "no_module"))]
|
|
Self::Export(_, pos) => *pos,
|
|
|
|
#[cfg(not(feature = "no_closure"))]
|
|
Self::Share(x) => x.pos,
|
|
}
|
|
}
|
|
/// Override the [position][Position] of this statement.
|
|
pub fn set_position(&mut self, new_pos: Position) -> &mut Self {
|
|
match self {
|
|
Self::Noop(pos)
|
|
| Self::Continue(pos)
|
|
| Self::Break(pos)
|
|
| Self::Block(_, pos)
|
|
| Self::Assignment(_, pos)
|
|
| Self::If(_, _, pos)
|
|
| Self::Switch(_, _, pos)
|
|
| Self::While(_, _, pos)
|
|
| Self::Do(_, _, _, pos)
|
|
| Self::For(_, _, pos)
|
|
| Self::Return((_, pos), _, _)
|
|
| Self::Let(_, _, _, pos)
|
|
| Self::Const(_, _, _, pos)
|
|
| Self::TryCatch(_, pos, _) => *pos = new_pos,
|
|
|
|
Self::Expr(x) => {
|
|
x.set_position(new_pos);
|
|
}
|
|
|
|
#[cfg(not(feature = "no_module"))]
|
|
Self::Import(_, _, pos) => *pos = new_pos,
|
|
#[cfg(not(feature = "no_module"))]
|
|
Self::Export(_, pos) => *pos = new_pos,
|
|
|
|
#[cfg(not(feature = "no_closure"))]
|
|
Self::Share(x) => x.pos = new_pos,
|
|
}
|
|
|
|
self
|
|
}
|
|
/// Is this statement self-terminated (i.e. no need for a semicolon terminator)?
|
|
pub fn is_self_terminated(&self) -> bool {
|
|
match self {
|
|
Self::If(_, _, _)
|
|
| Self::Switch(_, _, _)
|
|
| Self::While(_, _, _)
|
|
| Self::For(_, _, _)
|
|
| Self::Block(_, _)
|
|
| Self::TryCatch(_, _, _) => true,
|
|
|
|
// A No-op requires a semicolon in order to know it is an empty statement!
|
|
Self::Noop(_) => false,
|
|
|
|
Self::Let(_, _, _, _)
|
|
| Self::Const(_, _, _, _)
|
|
| Self::Assignment(_, _)
|
|
| Self::Expr(_)
|
|
| Self::Do(_, _, _, _)
|
|
| Self::Continue(_)
|
|
| Self::Break(_)
|
|
| Self::Return(_, _, _) => false,
|
|
|
|
#[cfg(not(feature = "no_module"))]
|
|
Self::Import(_, _, _) | Self::Export(_, _) => false,
|
|
|
|
#[cfg(not(feature = "no_closure"))]
|
|
Self::Share(_) => unreachable!("Stmt::Share should not be parsed"),
|
|
}
|
|
}
|
|
/// Is this statement _pure_?
|
|
///
|
|
/// A pure statement has no side effects.
|
|
pub fn is_pure(&self) -> bool {
|
|
match self {
|
|
Self::Noop(_) => true,
|
|
Self::Expr(expr) => expr.is_pure(),
|
|
Self::If(condition, x, _) => {
|
|
condition.is_pure()
|
|
&& x.0.is_pure()
|
|
&& x.1.as_ref().map(Stmt::is_pure).unwrap_or(true)
|
|
}
|
|
Self::Switch(expr, x, _) => {
|
|
expr.is_pure()
|
|
&& x.0.values().all(Stmt::is_pure)
|
|
&& x.1.as_ref().map(Stmt::is_pure).unwrap_or(true)
|
|
}
|
|
Self::While(condition, block, _) | Self::Do(block, condition, _, _) => {
|
|
condition.is_pure() && block.is_pure()
|
|
}
|
|
Self::For(iterable, x, _) => iterable.is_pure() && x.1.is_pure(),
|
|
Self::Let(_, _, _, _) | Self::Const(_, _, _, _) | Self::Assignment(_, _) => false,
|
|
Self::Block(block, _) => block.iter().all(|stmt| stmt.is_pure()),
|
|
Self::Continue(_) | Self::Break(_) | Self::Return(_, _, _) => false,
|
|
Self::TryCatch(x, _, _) => x.0.is_pure() && x.2.is_pure(),
|
|
|
|
#[cfg(not(feature = "no_module"))]
|
|
Self::Import(_, _, _) => false,
|
|
#[cfg(not(feature = "no_module"))]
|
|
Self::Export(_, _) => false,
|
|
|
|
#[cfg(not(feature = "no_closure"))]
|
|
Self::Share(_) => false,
|
|
}
|
|
}
|
|
/// Recursively walk this statement.
|
|
#[inline(always)]
|
|
pub fn walk<'a>(&'a self, path: &mut Vec<ASTNode<'a>>, on_node: &mut impl FnMut(&[ASTNode])) {
|
|
path.push(self.into());
|
|
on_node(path);
|
|
|
|
match self {
|
|
Self::Let(_, Some(e), _, _) | Self::Const(_, Some(e), _, _) => e.walk(path, on_node),
|
|
Self::If(e, x, _) => {
|
|
e.walk(path, on_node);
|
|
x.0.walk(path, on_node);
|
|
if let Some(ref s) = x.1 {
|
|
s.walk(path, on_node);
|
|
}
|
|
}
|
|
Self::Switch(e, x, _) => {
|
|
e.walk(path, on_node);
|
|
x.0.values().for_each(|s| s.walk(path, on_node));
|
|
if let Some(ref s) = x.1 {
|
|
s.walk(path, on_node);
|
|
}
|
|
}
|
|
Self::While(e, s, _) | Self::Do(s, e, _, _) => {
|
|
e.walk(path, on_node);
|
|
s.walk(path, on_node);
|
|
}
|
|
Self::For(e, x, _) => {
|
|
e.walk(path, on_node);
|
|
x.1.walk(path, on_node);
|
|
}
|
|
Self::Assignment(x, _) => {
|
|
x.0.walk(path, on_node);
|
|
x.2.walk(path, on_node);
|
|
}
|
|
Self::Block(x, _) => x.iter().for_each(|s| s.walk(path, on_node)),
|
|
Self::TryCatch(x, _, _) => {
|
|
x.0.walk(path, on_node);
|
|
x.2.walk(path, on_node);
|
|
}
|
|
Self::Expr(e) | Self::Return(_, Some(e), _) => e.walk(path, on_node),
|
|
#[cfg(not(feature = "no_module"))]
|
|
Self::Import(e, _, _) => e.walk(path, on_node),
|
|
_ => (),
|
|
}
|
|
|
|
path.pop().unwrap();
|
|
}
|
|
}
|
|
|
|
/// _(INTERNALS)_ A custom syntax expression.
|
|
/// Exported under the `internals` feature only.
|
|
///
|
|
/// # Volatile Data Structure
|
|
///
|
|
/// This type is volatile and may change.
|
|
#[derive(Debug, Clone, Hash)]
|
|
pub struct CustomExpr {
|
|
/// List of keywords.
|
|
pub keywords: StaticVec<Expr>,
|
|
/// List of tokens actually parsed.
|
|
pub tokens: Vec<ImmutableString>,
|
|
/// Delta number of variables in the scope.
|
|
pub scope_delta: isize,
|
|
}
|
|
|
|
/// _(INTERNALS)_ A binary expression.
|
|
/// Exported under the `internals` feature only.
|
|
///
|
|
/// # Volatile Data Structure
|
|
///
|
|
/// This type is volatile and may change.
|
|
#[derive(Debug, Clone, Hash)]
|
|
pub struct BinaryExpr {
|
|
/// LHS expression.
|
|
pub lhs: Expr,
|
|
/// RHS expression.
|
|
pub rhs: Expr,
|
|
}
|
|
|
|
/// _(INTERNALS)_ A function call.
|
|
/// Exported under the `internals` feature only.
|
|
///
|
|
/// # Volatile Data Structure
|
|
///
|
|
/// This type is volatile and may change.
|
|
#[derive(Debug, Clone, Default, Hash)]
|
|
pub struct FnCallExpr {
|
|
/// Pre-calculated hash for a script-defined function of the same name and number of parameters.
|
|
/// None if native Rust only.
|
|
pub hash_script: Option<NonZeroU64>,
|
|
/// Does this function call capture the parent scope?
|
|
pub capture: bool,
|
|
/// Default value when the function is not found, mostly used to provide a default for comparison functions.
|
|
pub def_value: Option<Dynamic>,
|
|
/// Namespace of the function, if any. Boxed because it occurs rarely.
|
|
pub namespace: Option<NamespaceRef>,
|
|
/// Function name.
|
|
/// Use [`Cow<'static, str>`][Cow] because a lot of operators (e.g. `==`, `>=`) are implemented as
|
|
/// function calls and the function names are predictable, so no need to allocate a new [`String`].
|
|
pub name: Cow<'static, str>,
|
|
/// List of function call arguments.
|
|
pub args: StaticVec<Expr>,
|
|
}
|
|
|
|
/// A type that wraps a [`FLOAT`] and implements [`Hash`].
|
|
#[cfg(not(feature = "no_float"))]
|
|
#[derive(Clone, Copy)]
|
|
pub struct FloatWrapper(FLOAT);
|
|
|
|
#[cfg(not(feature = "no_float"))]
|
|
impl Hash for FloatWrapper {
|
|
fn hash<H: crate::stdlib::hash::Hasher>(&self, state: &mut H) {
|
|
self.0.to_le_bytes().hash(state);
|
|
}
|
|
}
|
|
|
|
#[cfg(not(feature = "no_float"))]
|
|
impl AsRef<FLOAT> for FloatWrapper {
|
|
fn as_ref(&self) -> &FLOAT {
|
|
&self.0
|
|
}
|
|
}
|
|
|
|
#[cfg(not(feature = "no_float"))]
|
|
impl AsMut<FLOAT> for FloatWrapper {
|
|
fn as_mut(&mut self) -> &mut FLOAT {
|
|
&mut self.0
|
|
}
|
|
}
|
|
|
|
#[cfg(not(feature = "no_float"))]
|
|
impl crate::stdlib::ops::Deref for FloatWrapper {
|
|
type Target = FLOAT;
|
|
|
|
fn deref(&self) -> &Self::Target {
|
|
&self.0
|
|
}
|
|
}
|
|
|
|
#[cfg(not(feature = "no_float"))]
|
|
impl crate::stdlib::ops::DerefMut for FloatWrapper {
|
|
fn deref_mut(&mut self) -> &mut Self::Target {
|
|
&mut self.0
|
|
}
|
|
}
|
|
|
|
#[cfg(not(feature = "no_float"))]
|
|
impl fmt::Debug for FloatWrapper {
|
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
|
self.0.fmt(f)
|
|
}
|
|
}
|
|
|
|
#[cfg(not(feature = "no_float"))]
|
|
impl fmt::Display for FloatWrapper {
|
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
|
self.0.fmt(f)
|
|
}
|
|
}
|
|
|
|
#[cfg(not(feature = "no_float"))]
|
|
impl From<FLOAT> for FloatWrapper {
|
|
fn from(value: FLOAT) -> Self {
|
|
Self::new(value)
|
|
}
|
|
}
|
|
|
|
#[cfg(not(feature = "no_float"))]
|
|
impl FloatWrapper {
|
|
pub const fn new(value: FLOAT) -> Self {
|
|
Self(value)
|
|
}
|
|
}
|
|
|
|
/// _(INTERNALS)_ An expression sub-tree.
|
|
/// Exported under the `internals` feature only.
|
|
///
|
|
/// # Volatile Data Structure
|
|
///
|
|
/// This type is volatile and may change.
|
|
#[derive(Debug, Clone, Hash)]
|
|
pub enum Expr {
|
|
/// Dynamic constant.
|
|
/// Used to hold either an [`Array`] or [`Map`] literal for quick cloning.
|
|
/// All other primitive data types should use the appropriate variants for better speed.
|
|
DynamicConstant(Box<Dynamic>, Position),
|
|
/// Boolean constant.
|
|
BoolConstant(bool, Position),
|
|
/// Integer constant.
|
|
IntegerConstant(INT, Position),
|
|
/// Floating-point constant.
|
|
#[cfg(not(feature = "no_float"))]
|
|
FloatConstant(FloatWrapper, Position),
|
|
/// Character constant.
|
|
CharConstant(char, Position),
|
|
/// [String][ImmutableString] constant.
|
|
StringConstant(ImmutableString, Position),
|
|
/// [`FnPtr`] constant.
|
|
FnPointer(ImmutableString, Position),
|
|
/// [ expr, ... ]
|
|
Array(Box<StaticVec<Expr>>, Position),
|
|
/// #{ name:expr, ... }
|
|
Map(Box<StaticVec<(Ident, Expr)>>, Position),
|
|
/// ()
|
|
Unit(Position),
|
|
/// Variable access - (optional index, optional (hash, modules), variable name)
|
|
Variable(
|
|
Box<(
|
|
Option<NonZeroUsize>,
|
|
Option<(NonZeroU64, NamespaceRef)>,
|
|
Ident,
|
|
)>,
|
|
),
|
|
/// Property access - (getter, setter), prop
|
|
Property(Box<(ImmutableString, ImmutableString, Ident)>),
|
|
/// { [statement][Stmt] }
|
|
Stmt(Box<StaticVec<Stmt>>, Position),
|
|
/// func `(` expr `,` ... `)`
|
|
FnCall(Box<FnCallExpr>, Position),
|
|
/// lhs `.` rhs
|
|
Dot(Box<BinaryExpr>, Position),
|
|
/// expr `[` expr `]`
|
|
Index(Box<BinaryExpr>, Position),
|
|
/// lhs `in` rhs
|
|
In(Box<BinaryExpr>, Position),
|
|
/// lhs `&&` rhs
|
|
And(Box<BinaryExpr>, Position),
|
|
/// lhs `||` rhs
|
|
Or(Box<BinaryExpr>, Position),
|
|
/// Custom syntax
|
|
Custom(Box<CustomExpr>, Position),
|
|
}
|
|
|
|
impl Default for Expr {
|
|
#[inline(always)]
|
|
fn default() -> Self {
|
|
Self::Unit(Position::NONE)
|
|
}
|
|
}
|
|
|
|
impl Expr {
|
|
/// Get the [`Dynamic`] value of a constant expression.
|
|
///
|
|
/// Returns [`None`] if the expression is not constant.
|
|
pub fn get_constant_value(&self) -> Option<Dynamic> {
|
|
Some(match self {
|
|
Self::DynamicConstant(x, _) => x.as_ref().clone(),
|
|
Self::IntegerConstant(x, _) => (*x).into(),
|
|
#[cfg(not(feature = "no_float"))]
|
|
Self::FloatConstant(x, _) => (*x).into(),
|
|
Self::CharConstant(x, _) => (*x).into(),
|
|
Self::StringConstant(x, _) => x.clone().into(),
|
|
Self::FnPointer(x, _) => Dynamic(Union::FnPtr(
|
|
Box::new(FnPtr::new_unchecked(x.clone(), Default::default())),
|
|
AccessMode::ReadOnly,
|
|
)),
|
|
Self::BoolConstant(x, _) => (*x).into(),
|
|
Self::Unit(_) => Dynamic::UNIT,
|
|
|
|
#[cfg(not(feature = "no_index"))]
|
|
Self::Array(x, _) if self.is_constant() => {
|
|
let mut arr = Array::with_capacity(crate::stdlib::cmp::max(
|
|
crate::engine::TYPICAL_ARRAY_SIZE,
|
|
x.len(),
|
|
));
|
|
arr.extend(x.iter().map(|v| v.get_constant_value().unwrap()));
|
|
Dynamic(Union::Array(Box::new(arr), AccessMode::ReadOnly))
|
|
}
|
|
|
|
#[cfg(not(feature = "no_object"))]
|
|
Self::Map(x, _) if self.is_constant() => {
|
|
let mut map = Map::with_capacity(crate::stdlib::cmp::max(
|
|
crate::engine::TYPICAL_MAP_SIZE,
|
|
x.len(),
|
|
));
|
|
map.extend(
|
|
x.iter()
|
|
.map(|(k, v)| (k.name.clone(), v.get_constant_value().unwrap())),
|
|
);
|
|
Dynamic(Union::Map(Box::new(map), AccessMode::ReadOnly))
|
|
}
|
|
|
|
_ => return None,
|
|
})
|
|
}
|
|
/// Return the variable name if the expression a simple variable access.
|
|
#[inline(always)]
|
|
pub(crate) fn get_variable_access(&self, non_qualified: bool) -> Option<&str> {
|
|
match self {
|
|
Self::Variable(x) if !non_qualified || x.1.is_none() => Some((x.2).name.as_str()),
|
|
_ => None,
|
|
}
|
|
}
|
|
/// Get the [position][Position] of the expression.
|
|
pub fn position(&self) -> Position {
|
|
match self {
|
|
#[cfg(not(feature = "no_float"))]
|
|
Self::FloatConstant(_, pos) => *pos,
|
|
|
|
Self::DynamicConstant(_, pos) => *pos,
|
|
Self::BoolConstant(_, pos) => *pos,
|
|
Self::IntegerConstant(_, pos) => *pos,
|
|
Self::CharConstant(_, pos) => *pos,
|
|
Self::StringConstant(_, pos) => *pos,
|
|
Self::FnPointer(_, pos) => *pos,
|
|
Self::Array(_, pos) => *pos,
|
|
Self::Map(_, pos) => *pos,
|
|
Self::Property(x) => (x.2).pos,
|
|
Self::Stmt(_, pos) => *pos,
|
|
Self::Variable(x) => (x.2).pos,
|
|
Self::FnCall(_, pos) => *pos,
|
|
|
|
Self::And(x, _) | Self::Or(x, _) | Self::In(x, _) => x.lhs.position(),
|
|
|
|
Self::Unit(pos) => *pos,
|
|
|
|
Self::Dot(x, _) | Self::Index(x, _) => x.lhs.position(),
|
|
|
|
Self::Custom(_, pos) => *pos,
|
|
}
|
|
}
|
|
/// Override the [position][Position] of the expression.
|
|
pub fn set_position(&mut self, new_pos: Position) -> &mut Self {
|
|
match self {
|
|
#[cfg(not(feature = "no_float"))]
|
|
Self::FloatConstant(_, pos) => *pos = new_pos,
|
|
|
|
Self::DynamicConstant(_, pos) => *pos = new_pos,
|
|
Self::BoolConstant(_, pos) => *pos = new_pos,
|
|
Self::IntegerConstant(_, pos) => *pos = new_pos,
|
|
Self::CharConstant(_, pos) => *pos = new_pos,
|
|
Self::StringConstant(_, pos) => *pos = new_pos,
|
|
Self::FnPointer(_, pos) => *pos = new_pos,
|
|
Self::Array(_, pos) => *pos = new_pos,
|
|
Self::Map(_, pos) => *pos = new_pos,
|
|
Self::Variable(x) => (x.2).pos = new_pos,
|
|
Self::Property(x) => (x.2).pos = new_pos,
|
|
Self::Stmt(_, pos) => *pos = new_pos,
|
|
Self::FnCall(_, pos) => *pos = new_pos,
|
|
Self::And(_, pos) | Self::Or(_, pos) | Self::In(_, pos) => *pos = new_pos,
|
|
Self::Unit(pos) => *pos = new_pos,
|
|
Self::Dot(_, pos) | Self::Index(_, pos) => *pos = new_pos,
|
|
Self::Custom(_, pos) => *pos = new_pos,
|
|
}
|
|
|
|
self
|
|
}
|
|
/// Is the expression pure?
|
|
///
|
|
/// A pure expression has no side effects.
|
|
pub fn is_pure(&self) -> bool {
|
|
match self {
|
|
Self::Array(x, _) => x.iter().all(Self::is_pure),
|
|
|
|
Self::Map(x, _) => x.iter().map(|(_, v)| v).all(Self::is_pure),
|
|
|
|
Self::Index(x, _) | Self::And(x, _) | Self::Or(x, _) | Self::In(x, _) => {
|
|
x.lhs.is_pure() && x.rhs.is_pure()
|
|
}
|
|
|
|
Self::Stmt(x, _) => x.iter().all(Stmt::is_pure),
|
|
|
|
Self::Variable(_) => true,
|
|
|
|
_ => self.is_constant(),
|
|
}
|
|
}
|
|
/// Is the expression the unit `()` literal?
|
|
#[inline(always)]
|
|
pub fn is_unit(&self) -> bool {
|
|
match self {
|
|
Self::Unit(_) => true,
|
|
_ => false,
|
|
}
|
|
}
|
|
/// Is the expression a constant?
|
|
pub fn is_constant(&self) -> bool {
|
|
match self {
|
|
#[cfg(not(feature = "no_float"))]
|
|
Self::FloatConstant(_, _) => true,
|
|
|
|
Self::DynamicConstant(_, _)
|
|
| Self::BoolConstant(_, _)
|
|
| Self::IntegerConstant(_, _)
|
|
| Self::CharConstant(_, _)
|
|
| Self::StringConstant(_, _)
|
|
| Self::FnPointer(_, _)
|
|
| Self::Unit(_) => true,
|
|
|
|
// An array literal is constant if all items are constant
|
|
Self::Array(x, _) => x.iter().all(Self::is_constant),
|
|
|
|
// An map literal is constant if all items are constant
|
|
Self::Map(x, _) => x.iter().map(|(_, expr)| expr).all(Self::is_constant),
|
|
|
|
// Check in expression
|
|
Self::In(x, _) => match (&x.lhs, &x.rhs) {
|
|
(Self::StringConstant(_, _), Self::StringConstant(_, _))
|
|
| (Self::CharConstant(_, _), Self::StringConstant(_, _)) => true,
|
|
_ => false,
|
|
},
|
|
|
|
_ => false,
|
|
}
|
|
}
|
|
/// Is a particular [token][Token] allowed as a postfix operator to this expression?
|
|
pub fn is_valid_postfix(&self, token: &Token) -> bool {
|
|
match token {
|
|
#[cfg(not(feature = "no_object"))]
|
|
Token::Period => return true,
|
|
_ => (),
|
|
}
|
|
|
|
match self {
|
|
#[cfg(not(feature = "no_float"))]
|
|
Self::FloatConstant(_, _) => false,
|
|
|
|
Self::DynamicConstant(_, _)
|
|
| Self::BoolConstant(_, _)
|
|
| Self::IntegerConstant(_, _)
|
|
| Self::CharConstant(_, _)
|
|
| Self::FnPointer(_, _)
|
|
| Self::In(_, _)
|
|
| Self::And(_, _)
|
|
| Self::Or(_, _)
|
|
| Self::Unit(_) => false,
|
|
|
|
Self::StringConstant(_, _)
|
|
| Self::FnCall(_, _)
|
|
| Self::Stmt(_, _)
|
|
| Self::Dot(_, _)
|
|
| Self::Index(_, _)
|
|
| Self::Array(_, _)
|
|
| Self::Map(_, _) => match token {
|
|
#[cfg(not(feature = "no_index"))]
|
|
Token::LeftBracket => true,
|
|
_ => false,
|
|
},
|
|
|
|
Self::Variable(_) => match token {
|
|
#[cfg(not(feature = "no_index"))]
|
|
Token::LeftBracket => true,
|
|
Token::LeftParen => true,
|
|
Token::Bang => true,
|
|
Token::DoubleColon => true,
|
|
_ => false,
|
|
},
|
|
|
|
Self::Property(_) => match token {
|
|
#[cfg(not(feature = "no_index"))]
|
|
Token::LeftBracket => true,
|
|
Token::LeftParen => true,
|
|
_ => false,
|
|
},
|
|
|
|
Self::Custom(_, _) => false,
|
|
}
|
|
}
|
|
/// Recursively walk this expression.
|
|
#[inline(always)]
|
|
pub fn walk<'a>(&'a self, path: &mut Vec<ASTNode<'a>>, on_node: &mut impl FnMut(&[ASTNode])) {
|
|
path.push(self.into());
|
|
on_node(path);
|
|
|
|
match self {
|
|
Self::Stmt(x, _) => x.iter().for_each(|s| s.walk(path, on_node)),
|
|
Self::Array(x, _) => x.iter().for_each(|e| e.walk(path, on_node)),
|
|
Self::Map(x, _) => x.iter().for_each(|(_, e)| e.walk(path, on_node)),
|
|
Self::Index(x, _) | Expr::In(x, _) | Expr::And(x, _) | Expr::Or(x, _) => {
|
|
x.lhs.walk(path, on_node);
|
|
x.rhs.walk(path, on_node);
|
|
}
|
|
Self::Custom(x, _) => x.keywords.iter().for_each(|e| e.walk(path, on_node)),
|
|
_ => (),
|
|
}
|
|
|
|
path.pop().unwrap();
|
|
}
|
|
}
|
|
|
|
#[cfg(test)]
|
|
mod tests {
|
|
/// This test is to make sure no code changes increase the sizes of critical data structures.
|
|
#[test]
|
|
fn check_struct_sizes() {
|
|
use crate::stdlib::mem::size_of;
|
|
use crate::*;
|
|
|
|
assert_eq!(size_of::<Dynamic>(), 16);
|
|
assert_eq!(size_of::<Option<Dynamic>>(), 16);
|
|
assert_eq!(size_of::<Position>(), 4);
|
|
assert_eq!(size_of::<ast::Expr>(), 16);
|
|
assert_eq!(size_of::<Option<ast::Expr>>(), 16);
|
|
assert_eq!(size_of::<ast::Stmt>(), 32);
|
|
assert_eq!(size_of::<Option<ast::Stmt>>(), 32);
|
|
assert_eq!(size_of::<FnPtr>(), 32);
|
|
assert_eq!(size_of::<Scope>(), 48);
|
|
assert_eq!(size_of::<LexError>(), 56);
|
|
assert_eq!(size_of::<ParseError>(), 16);
|
|
assert_eq!(size_of::<EvalAltResult>(), 72);
|
|
}
|
|
}
|